C24H29ClN6O3 — CID 71256456
[1-[2-[(2-chlorophenyl)methylamino]pyrido[4,3-d]pyrimidin-5-yl]piperidin-3-yl] N-(3-methoxypropyl)carbamate (PubChem CID 71256456) has the molecular formula C24H29ClN6O3 and a molecular weight of 484.99 g/mol. Its IUPAC name is [1-[2-[(2-chlorophenyl)methylamino]pyrido[4,3-d]pyrimidin-5-yl]piperidin-3-yl] N-(3-methoxypropyl)carbamate.
| Compound Name | [1-[2-[(2-chlorophenyl)methylamino]pyrido[4,3-d]pyrimidin-5-yl]piperidin-3-yl] N-(3-methoxypropyl)carbamate |
|---|---|
| PubChem CID | 71256456 |
| Molecular Formula | C24H29ClN6O3 |
| Molecular Weight | 484.99 g/mol |
| Exact Mass | 484.20 |
| IUPAC Name | [1-[2-[(2-chlorophenyl)methylamino]pyrido[4,3-d]pyrimidin-5-yl]piperidin-3-yl] N-(3-methoxypropyl)carbamate |
| SMILES | COCCCNC(=O)OC1CCCN(c2nccc3nc(NCc4ccccc4Cl)ncc23)C1 |
| InChI | InChI=1S/C24H29ClN6O3/c1-33-13-5-10-27-24(32)34-18-7-4-12-31(16-18)22-19-15-29-23(30-21(19)9-11-26-22)28-14-17-6-2-3-8-20(17)25/h2-3,6,8-9,11,15,18H,4-5,7,10,12-14,16H2,1H3,(H,27,32)(H,28,29,30) |
| InChIKey | IXCWETUKJCVWCQ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 101.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.99 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|