C23H25ClN6O — CID 46221919
1-[2-[(2-chlorophenyl)methylamino]pyrido[4,3-d]pyrimidin-5-yl]-N-prop-2-enylpiperidine-4-carboxamide (PubChem CID 46221919) has the molecular formula C23H25ClN6O and a molecular weight of 436.95 g/mol. Its IUPAC name is 1-[2-[(2-chlorophenyl)methylamino]pyrido[4,3-d]pyrimidin-5-yl]-N-prop-2-enylpiperidine-4-carboxamide.
| Compound Name | 1-[2-[(2-chlorophenyl)methylamino]pyrido[4,3-d]pyrimidin-5-yl]-N-prop-2-enylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 46221919 |
| Molecular Formula | C23H25ClN6O |
| Molecular Weight | 436.95 g/mol |
| Exact Mass | 436.18 |
| IUPAC Name | 1-[2-[(2-chlorophenyl)methylamino]pyrido[4,3-d]pyrimidin-5-yl]-N-prop-2-enylpiperidine-4-carboxamide |
| SMILES | C=CCNC(=O)C1CCN(c2nccc3nc(NCc4ccccc4Cl)ncc23)CC1 |
| InChI | InChI=1S/C23H25ClN6O/c1-2-10-26-22(31)16-8-12-30(13-9-16)21-18-15-28-23(29-20(18)7-11-25-21)27-14-17-5-3-4-6-19(17)24/h2-7,11,15-16H,1,8-10,12-14H2,(H,26,31)(H,27,28,29) |
| InChIKey | DLAOTPZIZDYNEI-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 83.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.95 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|