C19H21NO4S — CID 58452675
3-cyclopropyl-6-[(E)-4-hydroxy-1-(4-methylsulfonylphenyl)but-1-enyl]-1H-pyridin-2-one (PubChem CID 58452675) has the molecular formula C19H21NO4S and a molecular weight of 359.45 g/mol. Its IUPAC name is 3-cyclopropyl-6-[(E)-4-hydroxy-1-(4-methylsulfonylphenyl)but-1-enyl]-1H-pyridin-2-one.
| Compound Name | 3-cyclopropyl-6-[(E)-4-hydroxy-1-(4-methylsulfonylphenyl)but-1-enyl]-1H-pyridin-2-one |
|---|---|
| PubChem CID | 58452675 |
| Molecular Formula | C19H21NO4S |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | 3-cyclopropyl-6-[(E)-4-hydroxy-1-(4-methylsulfonylphenyl)but-1-enyl]-1H-pyridin-2-one |
| SMILES | CS(=O)(=O)c1ccc(/C(=C\CCO)c2ccc(C3CC3)c(=O)[nH]2)cc1 |
| InChI | InChI=1S/C19H21NO4S/c1-25(23,24)15-8-6-13(7-9-15)16(3-2-12-21)18-11-10-17(14-4-5-14)19(22)20-18/h3,6-11,14,21H,2,4-5,12H2,1H3,(H,20,22)/b16-3+ |
| InChIKey | XWWMMOWTCCWPFN-HQYXKAPLSA-N |
| XLogP | 2.47 |
| TPSA | 87.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |