C24H28N2O4 — CID 67398063
3-cyclopropyl-6-[(Z)-1-[3-(4-hydroxybutoxy)phenyl]-2-[(2R)-5-oxopyrrolidin-2-yl]ethenyl]-1H-pyridin-2-one (PubChem CID 67398063) has the molecular formula C24H28N2O4 and a molecular weight of 408.50 g/mol. Its IUPAC name is 3-cyclopropyl-6-[(Z)-1-[3-(4-hydroxybutoxy)phenyl]-2-[(2R)-5-oxopyrrolidin-2-yl]ethenyl]-1H-pyridin-2-one.
| Compound Name | 3-cyclopropyl-6-[(Z)-1-[3-(4-hydroxybutoxy)phenyl]-2-[(2R)-5-oxopyrrolidin-2-yl]ethenyl]-1H-pyridin-2-one |
|---|---|
| PubChem CID | 67398063 |
| Molecular Formula | C24H28N2O4 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | 3-cyclopropyl-6-[(Z)-1-[3-(4-hydroxybutoxy)phenyl]-2-[(2R)-5-oxopyrrolidin-2-yl]ethenyl]-1H-pyridin-2-one |
| SMILES | O=C1CC[C@H](/C=C(/c2cccc(OCCCCO)c2)c2ccc(C3CC3)c(=O)[nH]2)N1 |
| InChI | InChI=1S/C24H28N2O4/c27-12-1-2-13-30-19-5-3-4-17(14-19)21(15-18-8-11-23(28)25-18)22-10-9-20(16-6-7-16)24(29)26-22/h3-5,9-10,14-16,18,27H,1-2,6-8,11-13H2,(H,25,28)(H,26,29)/b21-15-/t18-/m1/s1 |
| InChIKey | BXMZGUXICRTCCH-AFDUHFSSSA-N |
| XLogP | 3.11 |
| TPSA | 91.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|