C23H19ClFN5O5 — CID 58457086
(4R,6S,7S)-13-(6-chloropyrazin-2-yl)-17-fluoro-4,6-dimethylspiro[5,15-dioxa-2,14-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),10,12(16),13-tetraene-8,3'-piperidine]-2',4',6'-trione (PubChem CID 58457086) has the molecular formula C23H19ClFN5O5 and a molecular weight of 499.89 g/mol. Its IUPAC name is (4R,6S,7S)-13-(6-chloropyrazin-2-yl)-17-fluoro-4,6-dimethylspiro[5,15-dioxa-2,14-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),10,12(16),13-tetraene-8,3'-piperidine]-2',4',6'-trione.
| Compound Name | (4R,6S,7S)-13-(6-chloropyrazin-2-yl)-17-fluoro-4,6-dimethylspiro[5,15-dioxa-2,14-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),10,12(16),13-tetraene-8,3'-piperidine]-2',4',6'-trione |
|---|---|
| PubChem CID | 58457086 |
| Molecular Formula | C23H19ClFN5O5 |
| Molecular Weight | 499.89 g/mol |
| Exact Mass | 499.11 |
| IUPAC Name | (4R,6S,7S)-13-(6-chloropyrazin-2-yl)-17-fluoro-4,6-dimethylspiro[5,15-dioxa-2,14-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),10,12(16),13-tetraene-8,3'-piperidine]-2',4',6'-trione |
| SMILES | C[C@@H]1CN2c3c(cc4c(-c5cncc(Cl)n5)noc4c3F)CC3(C(=O)CC(=O)NC3=O)[C@H]2[C@H](C)O1 |
| InChI | InChI=1S/C23H19ClFN5O5/c1-9-8-30-19-11(5-23(21(30)10(2)34-9)14(31)4-16(32)28-22(23)33)3-12-18(29-35-20(12)17(19)25)13-6-26-7-15(24)27-13/h3,6-7,9-10,21H,4-5,8H2,1-2H3,(H,28,32,33)/t9-,10+,21-,23?/m1/s1 |
| InChIKey | HONTTWWLYDWAJI-MLEGXTESSA-N |
| XLogP | 2.22 |
| TPSA | 127.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.89 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|