C21H21FN4O6 — CID 58457016
(4R,6S,7S)-17-fluoro-N,4,6-trimethyl-2',4',6'-trioxospiro[5,15-dioxa-2,14-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),10,12(16),13-tetraene-8,3'-piperidine]-13-carboxamide (PubChem CID 58457016) has the molecular formula C21H21FN4O6 and a molecular weight of 444.42 g/mol. Its IUPAC name is (4R,6S,7S)-17-fluoro-N,4,6-trimethyl-2',4',6'-trioxospiro[5,15-dioxa-2,14-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),10,12(16),13-tetraene-8,3'-piperidine]-13-carboxamide.
| Compound Name | (4R,6S,7S)-17-fluoro-N,4,6-trimethyl-2',4',6'-trioxospiro[5,15-dioxa-2,14-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),10,12(16),13-tetraene-8,3'-piperidine]-13-carboxamide |
|---|---|
| PubChem CID | 58457016 |
| Molecular Formula | C21H21FN4O6 |
| Molecular Weight | 444.42 g/mol |
| Exact Mass | 444.14 |
| IUPAC Name | (4R,6S,7S)-17-fluoro-N,4,6-trimethyl-2',4',6'-trioxospiro[5,15-dioxa-2,14-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),10,12(16),13-tetraene-8,3'-piperidine]-13-carboxamide |
| SMILES | CNC(=O)c1noc2c(F)c3c(cc12)CC1(C(=O)CC(=O)NC1=O)[C@H]1[C@H](C)O[C@H](C)CN31 |
| InChI | InChI=1S/C21H21FN4O6/c1-8-7-26-16-10(4-11-15(19(29)23-3)25-32-17(11)14(16)22)6-21(18(26)9(2)31-8)12(27)5-13(28)24-20(21)30/h4,8-9,18H,5-7H2,1-3H3,(H,23,29)(H,24,28,30)/t8-,9+,18-,21?/m1/s1 |
| InChIKey | NEYIDXSXSQEHQX-WAPVCHIDSA-N |
| XLogP | 0.47 |
| TPSA | 130.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.42 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|