C23H21FN6O5S — CID 77291463
17'-fluoro-4',6'-dimethyl-13'-(5-methylsulfanylpyrazin-2-yl)spiro[1,3-diazinane-5,8'-5,15-dioxa-2,14-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),10,12(16),13-tetraene]-2,4,6-trione (PubChem CID 77291463) has the molecular formula C23H21FN6O5S and a molecular weight of 512.52 g/mol. Its IUPAC name is 17'-fluoro-4',6'-dimethyl-13'-(5-methylsulfanylpyrazin-2-yl)spiro[1,3-diazinane-5,8'-5,15-dioxa-2,14-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),10,12(16),13-tetraene]-2,4,6-trione.
| Compound Name | 17'-fluoro-4',6'-dimethyl-13'-(5-methylsulfanylpyrazin-2-yl)spiro[1,3-diazinane-5,8'-5,15-dioxa-2,14-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),10,12(16),13-tetraene]-2,4,6-trione |
|---|---|
| PubChem CID | 77291463 |
| Molecular Formula | C23H21FN6O5S |
| Molecular Weight | 512.52 g/mol |
| Exact Mass | 512.13 |
| IUPAC Name | 17'-fluoro-4',6'-dimethyl-13'-(5-methylsulfanylpyrazin-2-yl)spiro[1,3-diazinane-5,8'-5,15-dioxa-2,14-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),10,12(16),13-tetraene]-2,4,6-trione |
| SMILES | CSc1cnc(-c2noc3c(F)c4c(cc23)CC2(C(=O)NC(=O)NC2=O)C2C(C)OC(C)CN42)cn1 |
| InChI | InChI=1S/C23H21FN6O5S/c1-9-8-30-17-11(5-23(19(30)10(2)34-9)20(31)27-22(33)28-21(23)32)4-12-16(29-35-18(12)15(17)24)13-6-26-14(36-3)7-25-13/h4,6-7,9-10,19H,5,8H2,1-3H3,(H2,27,28,31,32,33) |
| InChIKey | NOXJFJCYWYXABJ-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 139.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.52 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|