C22H20FN5O5S — CID 77291364
17'-fluoro-4',6'-dimethyl-13'-(4-methyl-1,3-thiazol-5-yl)spiro[1,3-diazinane-5,8'-5,15-dioxa-2,14-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),10,12(16),13-tetraene]-2,4,6-trione (PubChem CID 77291364) has the molecular formula C22H20FN5O5S and a molecular weight of 485.50 g/mol. Its IUPAC name is 17'-fluoro-4',6'-dimethyl-13'-(4-methyl-1,3-thiazol-5-yl)spiro[1,3-diazinane-5,8'-5,15-dioxa-2,14-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),10,12(16),13-tetraene]-2,4,6-trione.
| Compound Name | 17'-fluoro-4',6'-dimethyl-13'-(4-methyl-1,3-thiazol-5-yl)spiro[1,3-diazinane-5,8'-5,15-dioxa-2,14-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),10,12(16),13-tetraene]-2,4,6-trione |
|---|---|
| PubChem CID | 77291364 |
| Molecular Formula | C22H20FN5O5S |
| Molecular Weight | 485.50 g/mol |
| Exact Mass | 485.12 |
| IUPAC Name | 17'-fluoro-4',6'-dimethyl-13'-(4-methyl-1,3-thiazol-5-yl)spiro[1,3-diazinane-5,8'-5,15-dioxa-2,14-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),10,12(16),13-tetraene]-2,4,6-trione |
| SMILES | Cc1ncsc1-c1noc2c(F)c3c(cc12)CC1(C(=O)NC(=O)NC1=O)C1C(C)OC(C)CN31 |
| InChI | InChI=1S/C22H20FN5O5S/c1-8-6-28-15-11(4-12-14(17-9(2)24-7-34-17)27-33-16(12)13(15)23)5-22(18(28)10(3)32-8)19(29)25-21(31)26-20(22)30/h4,7-8,10,18H,5-6H2,1-3H3,(H2,25,26,29,30,31) |
| InChIKey | PVNOUCKOXQSARZ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 126.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.50 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|