C23H22N6O5 — CID 67434000
(4'S,6'R,7'R)-4',6',17'-trimethyl-13'-pyrazin-2-ylspiro[1,3-diazinane-5,8'-5,15-dioxa-2,14-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),10,12(16),13-tetraene]-2,4,6-trione (PubChem CID 67434000) has the molecular formula C23H22N6O5 and a molecular weight of 462.47 g/mol. Its IUPAC name is (4'S,6'R,7'R)-4',6',17'-trimethyl-13'-pyrazin-2-ylspiro[1,3-diazinane-5,8'-5,15-dioxa-2,14-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),10,12(16),13-tetraene]-2,4,6-trione.
| Compound Name | (4'S,6'R,7'R)-4',6',17'-trimethyl-13'-pyrazin-2-ylspiro[1,3-diazinane-5,8'-5,15-dioxa-2,14-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),10,12(16),13-tetraene]-2,4,6-trione |
|---|---|
| PubChem CID | 67434000 |
| Molecular Formula | C23H22N6O5 |
| Molecular Weight | 462.47 g/mol |
| Exact Mass | 462.17 |
| IUPAC Name | (4'S,6'R,7'R)-4',6',17'-trimethyl-13'-pyrazin-2-ylspiro[1,3-diazinane-5,8'-5,15-dioxa-2,14-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),10,12(16),13-tetraene]-2,4,6-trione |
| SMILES | Cc1c2c(cc3c(-c4cnccn4)noc13)CC1(C(=O)NC(=O)NC1=O)[C@@H]1[C@@H](C)O[C@@H](C)CN21 |
| InChI | InChI=1S/C23H22N6O5/c1-10-9-29-17-11(2)18-14(16(28-34-18)15-8-24-4-5-25-15)6-13(17)7-23(19(29)12(3)33-10)20(30)26-22(32)27-21(23)31/h4-6,8,10,12,19H,7,9H2,1-3H3,(H2,26,27,30,31,32)/t10-,12+,19-/m0/s1 |
| InChIKey | SLJMUZVHADMOHF-DJHSXXLPSA-N |
| XLogP | 1.48 |
| TPSA | 139.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.47 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|