C31H56ClN3 — CID 58457313
4-[3-[[[(2R)-1-[4-(4-chlorocyclohexen-1-yl)piperidin-1-yl]-3-methylbutan-2-yl]amino]methyl]cyclohexyl]-N,N-dimethylcyclohexan-1-amine (PubChem CID 58457313) has the molecular formula C31H56ClN3 and a molecular weight of 506.26 g/mol. Its IUPAC name is 4-[3-[[[(2R)-1-[4-(4-chlorocyclohexen-1-yl)piperidin-1-yl]-3-methylbutan-2-yl]amino]methyl]cyclohexyl]-N,N-dimethylcyclohexan-1-amine.
| Compound Name | 4-[3-[[[(2R)-1-[4-(4-chlorocyclohexen-1-yl)piperidin-1-yl]-3-methylbutan-2-yl]amino]methyl]cyclohexyl]-N,N-dimethylcyclohexan-1-amine |
|---|---|
| PubChem CID | 58457313 |
| Molecular Formula | C31H56ClN3 |
| Molecular Weight | 506.26 g/mol |
| Exact Mass | 505.42 |
| IUPAC Name | 4-[3-[[[(2R)-1-[4-(4-chlorocyclohexen-1-yl)piperidin-1-yl]-3-methylbutan-2-yl]amino]methyl]cyclohexyl]-N,N-dimethylcyclohexan-1-amine |
| SMILES | CC(C)[C@H](CN1CCC(C2=CCC(Cl)CC2)CC1)NCC1CCCC(C2CCC(N(C)C)CC2)C1 |
| InChI | InChI=1S/C31H56ClN3/c1-23(2)31(22-35-18-16-27(17-19-35)25-8-12-29(32)13-9-25)33-21-24-6-5-7-28(20-24)26-10-14-30(15-11-26)34(3)4/h8,23-24,26-31,33H,5-7,9-22H2,1-4H3/t24?,26?,28?,29?,30?,31-/m0/s1 |
| InChIKey | OHOXAVZCLMEEPY-RBINLTLLSA-N |
| XLogP | 6.96 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.26 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|