C32H57ClFN3S — CID 58457850
(2R)-1-[(4R)-4-(4-chlorocyclohexen-1-yl)-3,3-dimethylpiperidin-1-yl]-N-[[3-[[(4-fluorocyclohexyl)sulfanylamino]methyl]cyclohexyl]methyl]-3-methylbutan-2-amine (PubChem CID 58457850) has the molecular formula C32H57ClFN3S and a molecular weight of 570.35 g/mol. Its IUPAC name is (2R)-1-[(4R)-4-(4-chlorocyclohexen-1-yl)-3,3-dimethylpiperidin-1-yl]-N-[[3-[[(4-fluorocyclohexyl)sulfanylamino]methyl]cyclohexyl]methyl]-3-methylbutan-2-amine.
| Compound Name | (2R)-1-[(4R)-4-(4-chlorocyclohexen-1-yl)-3,3-dimethylpiperidin-1-yl]-N-[[3-[[(4-fluorocyclohexyl)sulfanylamino]methyl]cyclohexyl]methyl]-3-methylbutan-2-amine |
|---|---|
| PubChem CID | 58457850 |
| Molecular Formula | C32H57ClFN3S |
| Molecular Weight | 570.35 g/mol |
| Exact Mass | 569.39 |
| IUPAC Name | (2R)-1-[(4R)-4-(4-chlorocyclohexen-1-yl)-3,3-dimethylpiperidin-1-yl]-N-[[3-[[(4-fluorocyclohexyl)sulfanylamino]methyl]cyclohexyl]methyl]-3-methylbutan-2-amine |
| SMILES | CC(C)[C@H](CN1CC[C@H](C2=CCC(Cl)CC2)C(C)(C)C1)NCC1CCCC(CNSC2CCC(F)CC2)C1 |
| InChI | InChI=1S/C32H57ClFN3S/c1-23(2)31(21-37-17-16-30(32(3,4)22-37)26-8-10-27(33)11-9-26)35-19-24-6-5-7-25(18-24)20-36-38-29-14-12-28(34)13-15-29/h8,23-25,27-31,35-36H,5-7,9-22H2,1-4H3/t24?,25?,27?,28?,29?,30-,31+/m1/s1 |
| InChIKey | ZFKBMOXQQAENNU-OMHDEFMASA-N |
| XLogP | 7.99 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.35 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|