C27H47ClN2 — CID 58457813
(2R)-1-[4-(4-chlorocyclohex-3-en-1-yl)-3,3-dimethylpiperidin-1-yl]-N-(3-cyclohex-3-en-1-ylpropyl)-3-methylbutan-2-amine (PubChem CID 58457813) has the molecular formula C27H47ClN2 and a molecular weight of 435.14 g/mol. Its IUPAC name is (2R)-1-[4-(4-chlorocyclohex-3-en-1-yl)-3,3-dimethylpiperidin-1-yl]-N-(3-cyclohex-3-en-1-ylpropyl)-3-methylbutan-2-amine.
| Compound Name | (2R)-1-[4-(4-chlorocyclohex-3-en-1-yl)-3,3-dimethylpiperidin-1-yl]-N-(3-cyclohex-3-en-1-ylpropyl)-3-methylbutan-2-amine |
|---|---|
| PubChem CID | 58457813 |
| Molecular Formula | C27H47ClN2 |
| Molecular Weight | 435.14 g/mol |
| Exact Mass | 434.34 |
| IUPAC Name | (2R)-1-[4-(4-chlorocyclohex-3-en-1-yl)-3,3-dimethylpiperidin-1-yl]-N-(3-cyclohex-3-en-1-ylpropyl)-3-methylbutan-2-amine |
| SMILES | CC(C)[C@H](CN1CCC(C2CC=C(Cl)CC2)C(C)(C)C1)NCCCC1CC=CCC1 |
| InChI | InChI=1S/C27H47ClN2/c1-21(2)26(29-17-8-11-22-9-6-5-7-10-22)19-30-18-16-25(27(3,4)20-30)23-12-14-24(28)15-13-23/h5-6,14,21-23,25-26,29H,7-13,15-20H2,1-4H3/t22?,23?,25?,26-/m0/s1 |
| InChIKey | VYHABHKTMNLECM-NHGWRGSNSA-N |
| XLogP | 7.01 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.14 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|