C19H35ClN2 — CID 58457259
(2R)-1-[4-(4-chlorocyclohexen-1-yl)-3,3-dimethylpiperidin-1-yl]-N,3-dimethylbutan-2-amine (PubChem CID 58457259) has the molecular formula C19H35ClN2 and a molecular weight of 326.96 g/mol. Its IUPAC name is (2R)-1-[4-(4-chlorocyclohexen-1-yl)-3,3-dimethylpiperidin-1-yl]-N,3-dimethylbutan-2-amine.
| Compound Name | (2R)-1-[4-(4-chlorocyclohexen-1-yl)-3,3-dimethylpiperidin-1-yl]-N,3-dimethylbutan-2-amine |
|---|---|
| PubChem CID | 58457259 |
| Molecular Formula | C19H35ClN2 |
| Molecular Weight | 326.96 g/mol |
| Exact Mass | 326.25 |
| IUPAC Name | (2R)-1-[4-(4-chlorocyclohexen-1-yl)-3,3-dimethylpiperidin-1-yl]-N,3-dimethylbutan-2-amine |
| SMILES | CN[C@@H](CN1CCC(C2=CCC(Cl)CC2)C(C)(C)C1)C(C)C |
| InChI | InChI=1S/C19H35ClN2/c1-14(2)18(21-5)12-22-11-10-17(19(3,4)13-22)15-6-8-16(20)9-7-15/h6,14,16-18,21H,7-13H2,1-5H3/t16?,17?,18-/m0/s1 |
| InChIKey | HKQBRSISIZJGNS-ABHNRTSZSA-N |
| XLogP | 4.30 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.96 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|