About carbanide;ethanethioylazanide;yttrium
carbanide;ethanethioylazanide;yttrium (PubChem CID 58458948) has the molecular formula C3H7NSY-2
and a molecular weight of 178.07 g/mol. Its IUPAC name is carbanide;ethanethioylazanide;yttrium.
Molecular Properties
| Compound Name | carbanide;ethanethioylazanide;yttrium |
| PubChem CID | 58458948 |
| Molecular Formula | C3H7NSY-2 |
| Molecular Weight | 178.07 g/mol |
| Exact Mass | 177.94 |
| IUPAC Name | carbanide;ethanethioylazanide;yttrium |
| SMILES | CC([NH-])=S.[CH3-].[Y] |
| InChI | InChI=1S/C2H5NS.CH3.Y/c1-2(3)4;;/h1H3,(H2,3,4);1H3;/q;-1;/p-1 |
| InChIKey | QSEUUKBIYKUPBC-UHFFFAOYSA-M |
| XLogP | 1.83 |
| TPSA | 23.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.07 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze carbanide;ethanethioylazanide;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbanide;ethanethioylazanide;yttrium?
The IUPAC name of carbanide;ethanethioylazanide;yttrium (CID 58458948) is carbanide;ethanethioylazanide;yttrium.
What is the SMILES notation for carbanide;ethanethioylazanide;yttrium?
The canonical SMILES for carbanide;ethanethioylazanide;yttrium is CC([NH-])=S.[CH3-].[Y].
What is the InChIKey of carbanide;ethanethioylazanide;yttrium?
The InChIKey is QSEUUKBIYKUPBC-UHFFFAOYSA-M. The full InChI is InChI=1S/C2H5NS.CH3.Y/c1-2(3)4;;/h1H3,(H2,3,4);1H3;/q;-1;/p-1.
What are the key properties of carbanide;ethanethioylazanide;yttrium?
carbanide;ethanethioylazanide;yttrium has a molecular weight of 178.07 g/mol, XLogP of 1.83, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for carbanide;ethanethioylazanide;yttrium is sourced from PubChem (CID 58458948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).