C22H29N3O2 — CID 58459027
1-(6-piperidin-4-yloxyisoquinolin-3-yl)-4-pyrrolidin-1-ylbutan-2-one (PubChem CID 58459027) has the molecular formula C22H29N3O2 and a molecular weight of 367.49 g/mol. Its IUPAC name is 1-(6-piperidin-4-yloxyisoquinolin-3-yl)-4-pyrrolidin-1-ylbutan-2-one.
| Compound Name | 1-(6-piperidin-4-yloxyisoquinolin-3-yl)-4-pyrrolidin-1-ylbutan-2-one |
|---|---|
| PubChem CID | 58459027 |
| Molecular Formula | C22H29N3O2 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.23 |
| IUPAC Name | 1-(6-piperidin-4-yloxyisoquinolin-3-yl)-4-pyrrolidin-1-ylbutan-2-one |
| SMILES | O=C(CCN1CCCC1)Cc1cc2cc(OC3CCNCC3)ccc2cn1 |
| InChI | InChI=1S/C22H29N3O2/c26-20(7-12-25-10-1-2-11-25)15-19-13-18-14-22(4-3-17(18)16-24-19)27-21-5-8-23-9-6-21/h3-4,13-14,16,21,23H,1-2,5-12,15H2 |
| InChIKey | NLGQPAHVLHTUFT-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |