C31H33N3O8 — CID 58461174
(4R,4aR,5aS,12aS)-4-(dimethylamino)-7-ethyl-1,10,11,12a-tetrahydroxy-3,12-dioxo-9-(3-oxo-3-pyridin-3-ylpropyl)-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 58461174) has the molecular formula C31H33N3O8 and a molecular weight of 575.62 g/mol. Its IUPAC name is (4R,4aR,5aS,12aS)-4-(dimethylamino)-7-ethyl-1,10,11,12a-tetrahydroxy-3,12-dioxo-9-(3-oxo-3-pyridin-3-ylpropyl)-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4R,4aR,5aS,12aS)-4-(dimethylamino)-7-ethyl-1,10,11,12a-tetrahydroxy-3,12-dioxo-9-(3-oxo-3-pyridin-3-ylpropyl)-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 58461174 |
| Molecular Formula | C31H33N3O8 |
| Molecular Weight | 575.62 g/mol |
| Exact Mass | 575.23 |
| IUPAC Name | (4R,4aR,5aS,12aS)-4-(dimethylamino)-7-ethyl-1,10,11,12a-tetrahydroxy-3,12-dioxo-9-(3-oxo-3-pyridin-3-ylpropyl)-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CCc1cc(CCC(=O)c2cccnc2)c(O)c2c1C[C@@H]1C[C@@H]3[C@@H](N(C)C)C(=O)C(C(N)=O)=C(O)[C@]3(O)C(=O)C1=C2O |
| InChI | InChI=1S/C31H33N3O8/c1-4-14-10-15(7-8-20(35)16-6-5-9-33-13-16)25(36)22-18(14)11-17-12-19-24(34(2)3)27(38)23(30(32)41)29(40)31(19,42)28(39)21(17)26(22)37/h5-6,9-10,13,17,19,24,36-37,40,42H,4,7-8,11-12H2,1-3H3,(H2,32,41)/t17-,19-,24-,31-/m1/s1 |
| InChIKey | MIMVKOBVZIHFQJ-CLSNYBMGSA-N |
| XLogP | 1.74 |
| TPSA | 191.35 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.62 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|