C29H32N4O9 — CID 58461158
(4aR,5aS,12aS)-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-9-[3-(1,2-oxazol-5-yl)-3-oxopropyl]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 58461158) has the molecular formula C29H32N4O9 and a molecular weight of 580.59 g/mol. Its IUPAC name is (4aR,5aS,12aS)-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-9-[3-(1,2-oxazol-5-yl)-3-oxopropyl]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4aR,5aS,12aS)-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-9-[3-(1,2-oxazol-5-yl)-3-oxopropyl]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 58461158 |
| Molecular Formula | C29H32N4O9 |
| Molecular Weight | 580.59 g/mol |
| Exact Mass | 580.22 |
| IUPAC Name | (4aR,5aS,12aS)-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-9-[3-(1,2-oxazol-5-yl)-3-oxopropyl]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CN(C)c1cc(CCC(=O)c2ccno2)c(O)c2c1C[C@@H]1C[C@@H]3C(N(C)C)C(=O)C(C(N)=O)=C(O)[C@]3(O)C(=O)C1=C2O |
| InChI | InChI=1S/C29H32N4O9/c1-32(2)16-11-12(5-6-17(34)18-7-8-31-42-18)23(35)20-14(16)9-13-10-15-22(33(3)4)25(37)21(28(30)40)27(39)29(15,41)26(38)19(13)24(20)36/h7-8,11,13,15,22,35-36,39,41H,5-6,9-10H2,1-4H3,(H2,30,40)/t13-,15-,22?,29-/m1/s1 |
| InChIKey | GFSPNHBOKRBQNU-LAXWXVKNSA-N |
| XLogP | 0.83 |
| TPSA | 207.73 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.59 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|