C12H11F4O9S- — CID 58463101
1,1,2,2-tetrafluoro-4-(2-hydroxy-5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonane-9-carbonyl)oxybutane-1-sulfonate (PubChem CID 58463101) has the molecular formula C12H11F4O9S- and a molecular weight of 407.27 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoro-4-(2-hydroxy-5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonane-9-carbonyl)oxybutane-1-sulfonate.
| Compound Name | 1,1,2,2-tetrafluoro-4-(2-hydroxy-5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonane-9-carbonyl)oxybutane-1-sulfonate |
|---|---|
| PubChem CID | 58463101 |
| Molecular Formula | C12H11F4O9S- |
| Molecular Weight | 407.27 g/mol |
| Exact Mass | 407.01 |
| IUPAC Name | 1,1,2,2-tetrafluoro-4-(2-hydroxy-5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonane-9-carbonyl)oxybutane-1-sulfonate |
| SMILES | O=C(OCCC(F)(F)C(F)(F)S(=O)(=O)[O-])C1C2OC3C(OC(=O)C31)C2O |
| InChI | InChI=1S/C12H12F4O9S/c13-11(14,12(15,16)26(20,21)22)1-2-23-9(18)3-4-7-8(25-10(4)19)5(17)6(3)24-7/h3-8,17H,1-2H2,(H,20,21,22)/p-1 |
| InChIKey | JNLYAZRDGHRUBB-UHFFFAOYSA-M |
| XLogP | -1.01 |
| TPSA | 139.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.27 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|