C12H19BrN3O4PS — CID 58463755
1-(2-bromoethyl)-2-[(5-nitrothiophen-2-yl)methoxy]-3-propyl-1,3,2λ5-diazaphospholidine 2-oxide (PubChem CID 58463755) has the molecular formula C12H19BrN3O4PS and a molecular weight of 412.25 g/mol. Its IUPAC name is 1-(2-bromoethyl)-2-[(5-nitrothiophen-2-yl)methoxy]-3-propyl-1,3,2λ5-diazaphospholidine 2-oxide.
| Compound Name | 1-(2-bromoethyl)-2-[(5-nitrothiophen-2-yl)methoxy]-3-propyl-1,3,2λ5-diazaphospholidine 2-oxide |
|---|---|
| PubChem CID | 58463755 |
| Molecular Formula | C12H19BrN3O4PS |
| Molecular Weight | 412.25 g/mol |
| Exact Mass | 411.00 |
| IUPAC Name | 1-(2-bromoethyl)-2-[(5-nitrothiophen-2-yl)methoxy]-3-propyl-1,3,2λ5-diazaphospholidine 2-oxide |
| SMILES | CCCN1CCN(CCBr)P1(=O)OCc1ccc([N+](=O)[O-])s1 |
| InChI | InChI=1S/C12H19BrN3O4PS/c1-2-6-14-8-9-15(7-5-13)21(14,19)20-10-11-3-4-12(22-11)16(17)18/h3-4H,2,5-10H2,1H3 |
| InChIKey | DUVBVHGLPYVMGL-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 75.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.25 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|