C14H23Cl3N3O4PS — CID 58463578
N-[bis(2-chloroethyl)amino-[(5-nitrothiophen-2-yl)methoxy]phosphoryl]-N-(2-chloroethyl)propan-1-amine (PubChem CID 58463578) has the molecular formula C14H23Cl3N3O4PS and a molecular weight of 466.76 g/mol. Its IUPAC name is N-[bis(2-chloroethyl)amino-[(5-nitrothiophen-2-yl)methoxy]phosphoryl]-N-(2-chloroethyl)propan-1-amine.
| Compound Name | N-[bis(2-chloroethyl)amino-[(5-nitrothiophen-2-yl)methoxy]phosphoryl]-N-(2-chloroethyl)propan-1-amine |
|---|---|
| PubChem CID | 58463578 |
| Molecular Formula | C14H23Cl3N3O4PS |
| Molecular Weight | 466.76 g/mol |
| Exact Mass | 465.02 |
| IUPAC Name | N-[bis(2-chloroethyl)amino-[(5-nitrothiophen-2-yl)methoxy]phosphoryl]-N-(2-chloroethyl)propan-1-amine |
| SMILES | CCCN(CCCl)P(=O)(OCc1ccc([N+](=O)[O-])s1)N(CCCl)CCCl |
| InChI | InChI=1S/C14H23Cl3N3O4PS/c1-2-8-18(9-5-15)25(23,19(10-6-16)11-7-17)24-12-13-3-4-14(26-13)20(21)22/h3-4H,2,5-12H2,1H3 |
| InChIKey | GIDHUQKXMAYDSV-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 75.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.76 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|