C15H26Cl3N2O2PS — CID 58463576
N-[bis(2-chloroethyl)amino-[(5-methylthiophen-2-yl)methoxy]phosphoryl]-N-(2-chloroethyl)propan-1-amine (PubChem CID 58463576) has the molecular formula C15H26Cl3N2O2PS and a molecular weight of 435.79 g/mol. Its IUPAC name is N-[bis(2-chloroethyl)amino-[(5-methylthiophen-2-yl)methoxy]phosphoryl]-N-(2-chloroethyl)propan-1-amine.
| Compound Name | N-[bis(2-chloroethyl)amino-[(5-methylthiophen-2-yl)methoxy]phosphoryl]-N-(2-chloroethyl)propan-1-amine |
|---|---|
| PubChem CID | 58463576 |
| Molecular Formula | C15H26Cl3N2O2PS |
| Molecular Weight | 435.79 g/mol |
| Exact Mass | 434.05 |
| IUPAC Name | N-[bis(2-chloroethyl)amino-[(5-methylthiophen-2-yl)methoxy]phosphoryl]-N-(2-chloroethyl)propan-1-amine |
| SMILES | CCCN(CCCl)P(=O)(OCc1ccc(C)s1)N(CCCl)CCCl |
| InChI | InChI=1S/C15H26Cl3N2O2PS/c1-3-9-19(10-6-16)23(21,20(11-7-17)12-8-18)22-13-15-5-4-14(2)24-15/h4-5H,3,6-13H2,1-2H3 |
| InChIKey | KCQDQHMYOAVKQA-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.79 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|