C13H20Cl4IN2O2PS — CID 163745030
N-[bis(2-chloroethyl)amino-[(5-iodothiophen-2-yl)methoxy]phosphoryl]-2-chloro-N-(2-chloroethyl)ethanamine (PubChem CID 163745030) has the molecular formula C13H20Cl4IN2O2PS and a molecular weight of 568.07 g/mol. Its IUPAC name is N-[bis(2-chloroethyl)amino-[(5-iodothiophen-2-yl)methoxy]phosphoryl]-2-chloro-N-(2-chloroethyl)ethanamine.
| Compound Name | N-[bis(2-chloroethyl)amino-[(5-iodothiophen-2-yl)methoxy]phosphoryl]-2-chloro-N-(2-chloroethyl)ethanamine |
|---|---|
| PubChem CID | 163745030 |
| Molecular Formula | C13H20Cl4IN2O2PS |
| Molecular Weight | 568.07 g/mol |
| Exact Mass | 565.88 |
| IUPAC Name | N-[bis(2-chloroethyl)amino-[(5-iodothiophen-2-yl)methoxy]phosphoryl]-2-chloro-N-(2-chloroethyl)ethanamine |
| SMILES | O=P(OCc1ccc(I)s1)(N(CCCl)CCCl)N(CCCl)CCCl |
| InChI | InChI=1S/C13H20Cl4IN2O2PS/c14-3-7-19(8-4-15)23(21,20(9-5-16)10-6-17)22-11-12-1-2-13(18)24-12/h1-2H,3-11H2 |
| InChIKey | LLCBCCKFSYJCMG-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.07 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|