C34H20F6N2O2 — CID 58465422
4,17-dimethyl-6,15-bis[4-(trifluoromethyl)phenyl]-3,18-dioxatetracyclo[12.4.0.02,7.08,13]octadeca-1(14),2(7),4,8,10,12,16-heptaene-5,16-dicarbonitrile (PubChem CID 58465422) has the molecular formula C34H20F6N2O2 and a molecular weight of 602.53 g/mol. Its IUPAC name is 4,17-dimethyl-6,15-bis[4-(trifluoromethyl)phenyl]-3,18-dioxatetracyclo[12.4.0.02,7.08,13]octadeca-1(14),2(7),4,8,10,12,16-heptaene-5,16-dicarbonitrile.
| Compound Name | 4,17-dimethyl-6,15-bis[4-(trifluoromethyl)phenyl]-3,18-dioxatetracyclo[12.4.0.02,7.08,13]octadeca-1(14),2(7),4,8,10,12,16-heptaene-5,16-dicarbonitrile |
|---|---|
| PubChem CID | 58465422 |
| Molecular Formula | C34H20F6N2O2 |
| Molecular Weight | 602.53 g/mol |
| Exact Mass | 602.14 |
| IUPAC Name | 4,17-dimethyl-6,15-bis[4-(trifluoromethyl)phenyl]-3,18-dioxatetracyclo[12.4.0.02,7.08,13]octadeca-1(14),2(7),4,8,10,12,16-heptaene-5,16-dicarbonitrile |
| SMILES | CC1=C(C#N)C(c2ccc(C(F)(F)F)cc2)c2c(c3c(c4ccccc24)C(c2ccc(C(F)(F)F)cc2)C(C#N)=C(C)O3)O1 |
| InChI | InChI=1S/C34H20F6N2O2/c1-17-25(15-41)27(19-7-11-21(12-8-19)33(35,36)37)29-23-5-3-4-6-24(23)30-28(20-9-13-22(14-10-20)34(38,39)40)26(16-42)18(2)44-32(30)31(29)43-17/h3-14,27-28H,1-2H3 |
| InChIKey | VDQLDRBFYKJICS-UHFFFAOYSA-N |
| XLogP | 9.52 |
| TPSA | 66.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.53 |
| LogP ≤ 5 | 9.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |