C13H13NOS — CID 58466012
CID 58466012 (PubChem CID 58466012) has the molecular formula C13H13NOS and a molecular weight of 231.32 g/mol.
| Compound Name | CID 58466012 |
|---|---|
| PubChem CID | 58466012 |
| Molecular Formula | C13H13NOS |
| Molecular Weight | 231.32 g/mol |
| Exact Mass | 231.07 |
| IUPAC Name | — |
| SMILES | [CH]CC1CC(=S)N(c2cccc(C)c2)C1=O |
| InChI | InChI=1S/C13H13NOS/c1-3-10-8-12(16)14(13(10)15)11-6-4-5-9(2)7-11/h1,4-7,10H,3,8H2,2H3 |
| InChIKey | KJDTYMIJVJPRBU-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.32 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|