C19H34O5 — CID 58468453
1,3-bis[(4R,6R)-6-ethyl-2,2-dimethyl-1,3-dioxan-4-yl]propan-1-one (PubChem CID 58468453) has the molecular formula C19H34O5 and a molecular weight of 342.48 g/mol. Its IUPAC name is 1,3-bis[(4R,6R)-6-ethyl-2,2-dimethyl-1,3-dioxan-4-yl]propan-1-one.
| Compound Name | 1,3-bis[(4R,6R)-6-ethyl-2,2-dimethyl-1,3-dioxan-4-yl]propan-1-one |
|---|---|
| PubChem CID | 58468453 |
| Molecular Formula | C19H34O5 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.24 |
| IUPAC Name | 1,3-bis[(4R,6R)-6-ethyl-2,2-dimethyl-1,3-dioxan-4-yl]propan-1-one |
| SMILES | CC[C@@H]1C[C@H](CCC(=O)[C@H]2C[C@@H](CC)OC(C)(C)O2)OC(C)(C)O1 |
| InChI | InChI=1S/C19H34O5/c1-7-13-11-15(23-18(3,4)21-13)9-10-16(20)17-12-14(8-2)22-19(5,6)24-17/h13-15,17H,7-12H2,1-6H3/t13-,14-,15+,17-/m1/s1 |
| InChIKey | WFQASPPJPYXWBS-PNBKFKSVSA-N |
| XLogP | 3.98 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |