C24H44O5 — CID 144843584
(4S,6S)-6-[[(4S,6R)-6-(3-ethyl-5-methylheptyl)-2,2-dimethyl-1,3-dioxan-4-yl]methyl]-2,2-dimethyl-1,3-dioxane-4-carbaldehyde (PubChem CID 144843584) has the molecular formula C24H44O5 and a molecular weight of 412.61 g/mol. Its IUPAC name is (4S,6S)-6-[[(4S,6R)-6-(3-ethyl-5-methylheptyl)-2,2-dimethyl-1,3-dioxan-4-yl]methyl]-2,2-dimethyl-1,3-dioxane-4-carbaldehyde.
| Compound Name | (4S,6S)-6-[[(4S,6R)-6-(3-ethyl-5-methylheptyl)-2,2-dimethyl-1,3-dioxan-4-yl]methyl]-2,2-dimethyl-1,3-dioxane-4-carbaldehyde |
|---|---|
| PubChem CID | 144843584 |
| Molecular Formula | C24H44O5 |
| Molecular Weight | 412.61 g/mol |
| Exact Mass | 412.32 |
| IUPAC Name | (4S,6S)-6-[[(4S,6R)-6-(3-ethyl-5-methylheptyl)-2,2-dimethyl-1,3-dioxan-4-yl]methyl]-2,2-dimethyl-1,3-dioxane-4-carbaldehyde |
| SMILES | CCC(C)CC(CC)CC[C@@H]1C[C@@H](C[C@H]2C[C@@H](C=O)OC(C)(C)O2)OC(C)(C)O1 |
| InChI | InChI=1S/C24H44O5/c1-8-17(3)12-18(9-2)10-11-19-13-20(27-23(4,5)26-19)14-21-15-22(16-25)29-24(6,7)28-21/h16-22H,8-15H2,1-7H3/t17?,18?,19-,20+,21+,22+/m1/s1 |
| InChIKey | ICODSKSYTUKAJI-ALGREANFSA-N |
| XLogP | 5.64 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.61 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|