C18H30O6 — CID 10871603
2-[(4aR,5R,7R,8aS)-7-formyl-2,2,4a-trimethyl-5,7,8,8a-tetrahydro-4H-pyrano[4,3-d][1,3]dioxin-5-yl]ethyl 2,2-dimethylpropanoate (PubChem CID 10871603) has the molecular formula C18H30O6 and a molecular weight of 342.43 g/mol. Its IUPAC name is 2-[(4aR,5R,7R,8aS)-7-formyl-2,2,4a-trimethyl-5,7,8,8a-tetrahydro-4H-pyrano[4,3-d][1,3]dioxin-5-yl]ethyl 2,2-dimethylpropanoate.
| Compound Name | 2-[(4aR,5R,7R,8aS)-7-formyl-2,2,4a-trimethyl-5,7,8,8a-tetrahydro-4H-pyrano[4,3-d][1,3]dioxin-5-yl]ethyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 10871603 |
| Molecular Formula | C18H30O6 |
| Molecular Weight | 342.43 g/mol |
| Exact Mass | 342.20 |
| IUPAC Name | 2-[(4aR,5R,7R,8aS)-7-formyl-2,2,4a-trimethyl-5,7,8,8a-tetrahydro-4H-pyrano[4,3-d][1,3]dioxin-5-yl]ethyl 2,2-dimethylpropanoate |
| SMILES | CC1(C)OC[C@@]2(C)[C@H](C[C@H](C=O)O[C@@H]2CCOC(=O)C(C)(C)C)O1 |
| InChI | InChI=1S/C18H30O6/c1-16(2,3)15(20)21-8-7-13-18(6)11-22-17(4,5)24-14(18)9-12(10-19)23-13/h10,12-14H,7-9,11H2,1-6H3/t12-,13-,14+,18-/m1/s1 |
| InChIKey | MHVYQZWFULCSBK-ZUMXRPEOSA-N |
| XLogP | 2.48 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.43 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|