C23H40O10 — CID 139249807
[(2S,4S,6R)-6-[(2S)-2,4-dihydroxybutyl]-2-[[(2S,6R)-6-formyl-4,4-dimethoxyoxan-2-yl]methyl]-2-methoxy-3,3-dimethyloxan-4-yl] acetate (PubChem CID 139249807) has the molecular formula C23H40O10 and a molecular weight of 476.56 g/mol. Its IUPAC name is [(2S,4S,6R)-6-[(2S)-2,4-dihydroxybutyl]-2-[[(2S,6R)-6-formyl-4,4-dimethoxyoxan-2-yl]methyl]-2-methoxy-3,3-dimethyloxan-4-yl] acetate.
| Compound Name | [(2S,4S,6R)-6-[(2S)-2,4-dihydroxybutyl]-2-[[(2S,6R)-6-formyl-4,4-dimethoxyoxan-2-yl]methyl]-2-methoxy-3,3-dimethyloxan-4-yl] acetate |
|---|---|
| PubChem CID | 139249807 |
| Molecular Formula | C23H40O10 |
| Molecular Weight | 476.56 g/mol |
| Exact Mass | 476.26 |
| IUPAC Name | [(2S,4S,6R)-6-[(2S)-2,4-dihydroxybutyl]-2-[[(2S,6R)-6-formyl-4,4-dimethoxyoxan-2-yl]methyl]-2-methoxy-3,3-dimethyloxan-4-yl] acetate |
| SMILES | COC1(OC)C[C@@H](C[C@]2(OC)O[C@H](C[C@@H](O)CCO)C[C@H](OC(C)=O)C2(C)C)O[C@@H](C=O)C1 |
| InChI | InChI=1S/C23H40O10/c1-15(26)31-20-10-17(9-16(27)7-8-24)33-23(30-6,21(20,2)3)13-18-11-22(28-4,29-5)12-19(14-25)32-18/h14,16-20,24,27H,7-13H2,1-6H3/t16-,17+,18-,19+,20-,23-/m0/s1 |
| InChIKey | KAZYHPSDQWHPPW-DXXALPQUSA-N |
| XLogP | 1.34 |
| TPSA | 129.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.56 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|