C23H44O5 — CID 123291310
6-[2-(2-hydroxypropan-2-yloxy)-7,9-dimethylundecyl]-2,2-dimethyl-1,3-dioxane-4-carbaldehyde (PubChem CID 123291310) has the molecular formula C23H44O5 and a molecular weight of 400.60 g/mol. Its IUPAC name is 6-[2-(2-hydroxypropan-2-yloxy)-7,9-dimethylundecyl]-2,2-dimethyl-1,3-dioxane-4-carbaldehyde.
| Compound Name | 6-[2-(2-hydroxypropan-2-yloxy)-7,9-dimethylundecyl]-2,2-dimethyl-1,3-dioxane-4-carbaldehyde |
|---|---|
| PubChem CID | 123291310 |
| Molecular Formula | C23H44O5 |
| Molecular Weight | 400.60 g/mol |
| Exact Mass | 400.32 |
| IUPAC Name | 6-[2-(2-hydroxypropan-2-yloxy)-7,9-dimethylundecyl]-2,2-dimethyl-1,3-dioxane-4-carbaldehyde |
| SMILES | CCC(C)CC(C)CCCCC(CC1CC(C=O)OC(C)(C)O1)OC(C)(C)O |
| InChI | InChI=1S/C23H44O5/c1-8-17(2)13-18(3)11-9-10-12-19(26-22(4,5)25)14-20-15-21(16-24)28-23(6,7)27-20/h16-21,25H,8-15H2,1-7H3 |
| InChIKey | WLRNCIHKPPNCOE-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.60 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|