C17H28O5 — CID 11522492
[(2R)-2-[(2R,3S,6R,8R,9R)-8-formyl-3,9-dimethyl-1,7-dioxaspiro[5.5]undecan-2-yl]propyl] acetate (PubChem CID 11522492) has the molecular formula C17H28O5 and a molecular weight of 312.41 g/mol. Its IUPAC name is [(2R)-2-[(2R,3S,6R,8R,9R)-8-formyl-3,9-dimethyl-1,7-dioxaspiro[5.5]undecan-2-yl]propyl] acetate.
| Compound Name | [(2R)-2-[(2R,3S,6R,8R,9R)-8-formyl-3,9-dimethyl-1,7-dioxaspiro[5.5]undecan-2-yl]propyl] acetate |
|---|---|
| PubChem CID | 11522492 |
| Molecular Formula | C17H28O5 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.19 |
| IUPAC Name | [(2R)-2-[(2R,3S,6R,8R,9R)-8-formyl-3,9-dimethyl-1,7-dioxaspiro[5.5]undecan-2-yl]propyl] acetate |
| SMILES | CC(=O)OC[C@@H](C)[C@@H]1O[C@]2(CC[C@@H](C)[C@H](C=O)O2)CC[C@@H]1C |
| InChI | InChI=1S/C17H28O5/c1-11-5-7-17(21-15(11)9-18)8-6-12(2)16(22-17)13(3)10-20-14(4)19/h9,11-13,15-16H,5-8,10H2,1-4H3/t11-,12+,13-,15+,16-,17-/m1/s1 |
| InChIKey | VMTXOSIJGLDJFM-DNUWFKPPSA-N |
| XLogP | 2.71 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|