C22H38O4 — CID 10451559
(4R)-4-[(2S,3S,6R,8S,9R)-3,9-dimethyl-8-[(3S)-3-methyl-4-oxopentyl]-1,7-dioxaspiro[5.5]undecan-2-yl]pentanal (PubChem CID 10451559) has the molecular formula C22H38O4 and a molecular weight of 366.54 g/mol. Its IUPAC name is (4R)-4-[(2S,3S,6R,8S,9R)-3,9-dimethyl-8-[(3S)-3-methyl-4-oxopentyl]-1,7-dioxaspiro[5.5]undecan-2-yl]pentanal.
| Compound Name | (4R)-4-[(2S,3S,6R,8S,9R)-3,9-dimethyl-8-[(3S)-3-methyl-4-oxopentyl]-1,7-dioxaspiro[5.5]undecan-2-yl]pentanal |
|---|---|
| PubChem CID | 10451559 |
| Molecular Formula | C22H38O4 |
| Molecular Weight | 366.54 g/mol |
| Exact Mass | 366.28 |
| IUPAC Name | (4R)-4-[(2S,3S,6R,8S,9R)-3,9-dimethyl-8-[(3S)-3-methyl-4-oxopentyl]-1,7-dioxaspiro[5.5]undecan-2-yl]pentanal |
| SMILES | CC(=O)[C@@H](C)CC[C@@H]1O[C@@]2(CC[C@H]1C)CC[C@H](C)[C@H]([C@H](C)CCC=O)O2 |
| InChI | InChI=1S/C22H38O4/c1-15(19(5)24)8-9-20-16(2)10-12-22(25-20)13-11-18(4)21(26-22)17(3)7-6-14-23/h14-18,20-21H,6-13H2,1-5H3/t15-,16+,17+,18-,20-,21-,22+/m0/s1 |
| InChIKey | SVEKMKBHTOFGLQ-TVEXYEQESA-N |
| XLogP | 4.93 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.54 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|