C18H13N3O3S — CID 58470561
2-[[2-[6-(3-isocyanophenyl)-1,3-benzothiazol-2-yl]acetyl]amino]acetic acid (PubChem CID 58470561) has the molecular formula C18H13N3O3S and a molecular weight of 351.39 g/mol. Its IUPAC name is 2-[[2-[6-(3-isocyanophenyl)-1,3-benzothiazol-2-yl]acetyl]amino]acetic acid.
| Compound Name | 2-[[2-[6-(3-isocyanophenyl)-1,3-benzothiazol-2-yl]acetyl]amino]acetic acid |
|---|---|
| PubChem CID | 58470561 |
| Molecular Formula | C18H13N3O3S |
| Molecular Weight | 351.39 g/mol |
| Exact Mass | 351.07 |
| IUPAC Name | 2-[[2-[6-(3-isocyanophenyl)-1,3-benzothiazol-2-yl]acetyl]amino]acetic acid |
| SMILES | [C-]#[N+]c1cccc(-c2ccc3nc(CC(=O)NCC(=O)O)sc3c2)c1 |
| InChI | InChI=1S/C18H13N3O3S/c1-19-13-4-2-3-11(7-13)12-5-6-14-15(8-12)25-17(21-14)9-16(22)20-10-18(23)24/h2-8H,9-10H2,(H,20,22)(H,23,24) |
| InChIKey | YBUUXTXTCPIPEM-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 83.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.39 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|