C20H15F3N4O2S — CID 88895114
N-[2-(cyanomethylamino)-2-oxoethyl]-2-[6-[3-(trifluoromethyl)phenyl]-1,3-benzothiazol-2-yl]acetamide (PubChem CID 88895114) has the molecular formula C20H15F3N4O2S and a molecular weight of 432.43 g/mol. Its IUPAC name is N-[2-(cyanomethylamino)-2-oxoethyl]-2-[6-[3-(trifluoromethyl)phenyl]-1,3-benzothiazol-2-yl]acetamide.
| Compound Name | N-[2-(cyanomethylamino)-2-oxoethyl]-2-[6-[3-(trifluoromethyl)phenyl]-1,3-benzothiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 88895114 |
| Molecular Formula | C20H15F3N4O2S |
| Molecular Weight | 432.43 g/mol |
| Exact Mass | 432.09 |
| IUPAC Name | N-[2-(cyanomethylamino)-2-oxoethyl]-2-[6-[3-(trifluoromethyl)phenyl]-1,3-benzothiazol-2-yl]acetamide |
| SMILES | N#CCNC(=O)CNC(=O)Cc1nc2ccc(-c3cccc(C(F)(F)F)c3)cc2s1 |
| InChI | InChI=1S/C20H15F3N4O2S/c21-20(22,23)14-3-1-2-12(8-14)13-4-5-15-16(9-13)30-19(27-15)10-17(28)26-11-18(29)25-7-6-24/h1-5,8-9H,7,10-11H2,(H,25,29)(H,26,28) |
| InChIKey | AQMWQNCDWPFZHU-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 94.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.43 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|