C21H17FN2O2S — CID 58470614
2-[6-(3-fluorophenyl)-1,3-benzothiazol-2-yl]-N-(2-oxohex-5-ynyl)acetamide (PubChem CID 58470614) has the molecular formula C21H17FN2O2S and a molecular weight of 380.44 g/mol. Its IUPAC name is 2-[6-(3-fluorophenyl)-1,3-benzothiazol-2-yl]-N-(2-oxohex-5-ynyl)acetamide.
| Compound Name | 2-[6-(3-fluorophenyl)-1,3-benzothiazol-2-yl]-N-(2-oxohex-5-ynyl)acetamide |
|---|---|
| PubChem CID | 58470614 |
| Molecular Formula | C21H17FN2O2S |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.10 |
| IUPAC Name | 2-[6-(3-fluorophenyl)-1,3-benzothiazol-2-yl]-N-(2-oxohex-5-ynyl)acetamide |
| SMILES | C#CCCC(=O)CNC(=O)Cc1nc2ccc(-c3cccc(F)c3)cc2s1 |
| InChI | InChI=1S/C21H17FN2O2S/c1-2-3-7-17(25)13-23-20(26)12-21-24-18-9-8-15(11-19(18)27-21)14-5-4-6-16(22)10-14/h1,4-6,8-11H,3,7,12-13H2,(H,23,26) |
| InChIKey | AAEHJMPEMPHVHF-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|