C20H17FN4O3S — CID 88895005
N-[2-(cyanomethylamino)-2-oxoethyl]-2-[6-(3-fluorophenyl)-5-methoxy-1,3-benzothiazol-2-yl]acetamide (PubChem CID 88895005) has the molecular formula C20H17FN4O3S and a molecular weight of 412.45 g/mol. Its IUPAC name is N-[2-(cyanomethylamino)-2-oxoethyl]-2-[6-(3-fluorophenyl)-5-methoxy-1,3-benzothiazol-2-yl]acetamide.
| Compound Name | N-[2-(cyanomethylamino)-2-oxoethyl]-2-[6-(3-fluorophenyl)-5-methoxy-1,3-benzothiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 88895005 |
| Molecular Formula | C20H17FN4O3S |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.10 |
| IUPAC Name | N-[2-(cyanomethylamino)-2-oxoethyl]-2-[6-(3-fluorophenyl)-5-methoxy-1,3-benzothiazol-2-yl]acetamide |
| SMILES | COc1cc2nc(CC(=O)NCC(=O)NCC#N)sc2cc1-c1cccc(F)c1 |
| InChI | InChI=1S/C20H17FN4O3S/c1-28-16-9-15-17(8-14(16)12-3-2-4-13(21)7-12)29-20(25-15)10-18(26)24-11-19(27)23-6-5-22/h2-4,7-9H,6,10-11H2,1H3,(H,23,27)(H,24,26) |
| InChIKey | RVBMFYPOGNKDHL-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 104.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|