C20H19N5O4S2 — CID 88913925
N-[2-(cyanomethylamino)-2-oxoethyl]-2-[6-(3-methylsulfonylanilino)-1,3-benzothiazol-2-yl]acetamide (PubChem CID 88913925) has the molecular formula C20H19N5O4S2 and a molecular weight of 457.54 g/mol. Its IUPAC name is N-[2-(cyanomethylamino)-2-oxoethyl]-2-[6-(3-methylsulfonylanilino)-1,3-benzothiazol-2-yl]acetamide.
| Compound Name | N-[2-(cyanomethylamino)-2-oxoethyl]-2-[6-(3-methylsulfonylanilino)-1,3-benzothiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 88913925 |
| Molecular Formula | C20H19N5O4S2 |
| Molecular Weight | 457.54 g/mol |
| Exact Mass | 457.09 |
| IUPAC Name | N-[2-(cyanomethylamino)-2-oxoethyl]-2-[6-(3-methylsulfonylanilino)-1,3-benzothiazol-2-yl]acetamide |
| SMILES | CS(=O)(=O)c1cccc(Nc2ccc3nc(CC(=O)NCC(=O)NCC#N)sc3c2)c1 |
| InChI | InChI=1S/C20H19N5O4S2/c1-31(28,29)15-4-2-3-13(9-15)24-14-5-6-16-17(10-14)30-20(25-16)11-18(26)23-12-19(27)22-8-7-21/h2-6,9-10,24H,8,11-12H2,1H3,(H,22,27)(H,23,26) |
| InChIKey | SNUPZCRQDUBXRX-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 141.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.54 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|