C15H13N5O4S2 — CID 88936591
N-(cyanomethyl)-2-[5-[(6-methylsulfonyl-1,3-benzothiazol-2-yl)methyl]-1,3,4-oxadiazol-2-yl]acetamide (PubChem CID 88936591) has the molecular formula C15H13N5O4S2 and a molecular weight of 391.43 g/mol. Its IUPAC name is N-(cyanomethyl)-2-[5-[(6-methylsulfonyl-1,3-benzothiazol-2-yl)methyl]-1,3,4-oxadiazol-2-yl]acetamide.
| Compound Name | N-(cyanomethyl)-2-[5-[(6-methylsulfonyl-1,3-benzothiazol-2-yl)methyl]-1,3,4-oxadiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 88936591 |
| Molecular Formula | C15H13N5O4S2 |
| Molecular Weight | 391.43 g/mol |
| Exact Mass | 391.04 |
| IUPAC Name | N-(cyanomethyl)-2-[5-[(6-methylsulfonyl-1,3-benzothiazol-2-yl)methyl]-1,3,4-oxadiazol-2-yl]acetamide |
| SMILES | CS(=O)(=O)c1ccc2nc(Cc3nnc(CC(=O)NCC#N)o3)sc2c1 |
| InChI | InChI=1S/C15H13N5O4S2/c1-26(22,23)9-2-3-10-11(6-9)25-15(18-10)8-14-20-19-13(24-14)7-12(21)17-5-4-16/h2-3,6H,5,7-8H2,1H3,(H,17,21) |
| InChIKey | YUXHGEQYBYOTPL-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 138.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.43 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|