C21H16N4O2S — CID 88981817
N-(cyanomethyl)-2-[5-[(6-phenyl-1-benzothiophen-2-yl)methyl]-1,3,4-oxadiazol-2-yl]acetamide (PubChem CID 88981817) has the molecular formula C21H16N4O2S and a molecular weight of 388.45 g/mol. Its IUPAC name is N-(cyanomethyl)-2-[5-[(6-phenyl-1-benzothiophen-2-yl)methyl]-1,3,4-oxadiazol-2-yl]acetamide.
| Compound Name | N-(cyanomethyl)-2-[5-[(6-phenyl-1-benzothiophen-2-yl)methyl]-1,3,4-oxadiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 88981817 |
| Molecular Formula | C21H16N4O2S |
| Molecular Weight | 388.45 g/mol |
| Exact Mass | 388.10 |
| IUPAC Name | N-(cyanomethyl)-2-[5-[(6-phenyl-1-benzothiophen-2-yl)methyl]-1,3,4-oxadiazol-2-yl]acetamide |
| SMILES | N#CCNC(=O)Cc1nnc(Cc2cc3ccc(-c4ccccc4)cc3s2)o1 |
| InChI | InChI=1S/C21H16N4O2S/c22-8-9-23-19(26)13-21-25-24-20(27-21)12-17-10-16-7-6-15(11-18(16)28-17)14-4-2-1-3-5-14/h1-7,10-11H,9,12-13H2,(H,23,26) |
| InChIKey | JOEHSGMRHJXCBG-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 91.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.45 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|