C20H15N5O2S — CID 70801145
N-(2-cyanoethyl)-5-[(6-phenyl-1,3-benzothiazol-2-yl)methyl]-1,3,4-oxadiazole-2-carboxamide (PubChem CID 70801145) has the molecular formula C20H15N5O2S and a molecular weight of 389.44 g/mol. Its IUPAC name is N-(2-cyanoethyl)-5-[(6-phenyl-1,3-benzothiazol-2-yl)methyl]-1,3,4-oxadiazole-2-carboxamide.
| Compound Name | N-(2-cyanoethyl)-5-[(6-phenyl-1,3-benzothiazol-2-yl)methyl]-1,3,4-oxadiazole-2-carboxamide |
|---|---|
| PubChem CID | 70801145 |
| Molecular Formula | C20H15N5O2S |
| Molecular Weight | 389.44 g/mol |
| Exact Mass | 389.09 |
| IUPAC Name | N-(2-cyanoethyl)-5-[(6-phenyl-1,3-benzothiazol-2-yl)methyl]-1,3,4-oxadiazole-2-carboxamide |
| SMILES | N#CCCNC(=O)c1nnc(Cc2nc3ccc(-c4ccccc4)cc3s2)o1 |
| InChI | InChI=1S/C20H15N5O2S/c21-9-4-10-22-19(26)20-25-24-17(27-20)12-18-23-15-8-7-14(11-16(15)28-18)13-5-2-1-3-6-13/h1-3,5-8,11H,4,10,12H2,(H,22,26) |
| InChIKey | RBUIVGBIEFYNIO-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 104.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.44 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|