C19H15ClN4O2S — CID 58470317
2-(7-chloro-6-phenyl-1,3-benzothiazol-2-yl)-N-[2-(cyanomethylamino)-2-oxoethyl]acetamide (PubChem CID 58470317) has the molecular formula C19H15ClN4O2S and a molecular weight of 398.88 g/mol. Its IUPAC name is 2-(7-chloro-6-phenyl-1,3-benzothiazol-2-yl)-N-[2-(cyanomethylamino)-2-oxoethyl]acetamide.
| Compound Name | 2-(7-chloro-6-phenyl-1,3-benzothiazol-2-yl)-N-[2-(cyanomethylamino)-2-oxoethyl]acetamide |
|---|---|
| PubChem CID | 58470317 |
| Molecular Formula | C19H15ClN4O2S |
| Molecular Weight | 398.88 g/mol |
| Exact Mass | 398.06 |
| IUPAC Name | 2-(7-chloro-6-phenyl-1,3-benzothiazol-2-yl)-N-[2-(cyanomethylamino)-2-oxoethyl]acetamide |
| SMILES | N#CCNC(=O)CNC(=O)Cc1nc2ccc(-c3ccccc3)c(Cl)c2s1 |
| InChI | InChI=1S/C19H15ClN4O2S/c20-18-13(12-4-2-1-3-5-12)6-7-14-19(18)27-17(24-14)10-15(25)23-11-16(26)22-9-8-21/h1-7H,9-11H2,(H,22,26)(H,23,25) |
| InChIKey | BNTOXIKIARFDMN-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 94.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.88 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|