C22H20N2O3S — CID 58470249
2-(5-methoxy-6-phenyl-1,3-benzothiazol-2-yl)-N-(2-oxohex-5-ynyl)acetamide (PubChem CID 58470249) has the molecular formula C22H20N2O3S and a molecular weight of 392.48 g/mol. Its IUPAC name is 2-(5-methoxy-6-phenyl-1,3-benzothiazol-2-yl)-N-(2-oxohex-5-ynyl)acetamide.
| Compound Name | 2-(5-methoxy-6-phenyl-1,3-benzothiazol-2-yl)-N-(2-oxohex-5-ynyl)acetamide |
|---|---|
| PubChem CID | 58470249 |
| Molecular Formula | C22H20N2O3S |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | 2-(5-methoxy-6-phenyl-1,3-benzothiazol-2-yl)-N-(2-oxohex-5-ynyl)acetamide |
| SMILES | C#CCCC(=O)CNC(=O)Cc1nc2cc(OC)c(-c3ccccc3)cc2s1 |
| InChI | InChI=1S/C22H20N2O3S/c1-3-4-10-16(25)14-23-21(26)13-22-24-18-12-19(27-2)17(11-20(18)28-22)15-8-6-5-7-9-15/h1,5-9,11-12H,4,10,13-14H2,2H3,(H,23,26) |
| InChIKey | QULMNRPKZQLZNK-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|