C22H23N5O2S — CID 58470726
N-[2-(cyanomethylamino)-2-oxoethyl]-2-[5-(N-propylanilino)-1,3-benzothiazol-2-yl]acetamide (PubChem CID 58470726) has the molecular formula C22H23N5O2S and a molecular weight of 421.53 g/mol. Its IUPAC name is N-[2-(cyanomethylamino)-2-oxoethyl]-2-[5-(N-propylanilino)-1,3-benzothiazol-2-yl]acetamide.
| Compound Name | N-[2-(cyanomethylamino)-2-oxoethyl]-2-[5-(N-propylanilino)-1,3-benzothiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 58470726 |
| Molecular Formula | C22H23N5O2S |
| Molecular Weight | 421.53 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | N-[2-(cyanomethylamino)-2-oxoethyl]-2-[5-(N-propylanilino)-1,3-benzothiazol-2-yl]acetamide |
| SMILES | CCCN(c1ccccc1)c1ccc2sc(CC(=O)NCC(=O)NCC#N)nc2c1 |
| InChI | InChI=1S/C22H23N5O2S/c1-2-12-27(16-6-4-3-5-7-16)17-8-9-19-18(13-17)26-22(30-19)14-20(28)25-15-21(29)24-11-10-23/h3-9,13H,2,11-12,14-15H2,1H3,(H,24,29)(H,25,28) |
| InChIKey | TXQQQQKALDHNLV-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 98.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.53 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|