C16H16FN7 — CID 58476020
7-fluoro-9-isocyano-2-methyl-5-(4-methylpiperazin-1-yl)-[1,2,4]triazolo[1,5-c]quinazoline (PubChem CID 58476020) has the molecular formula C16H16FN7 and a molecular weight of 325.35 g/mol. Its IUPAC name is 7-fluoro-9-isocyano-2-methyl-5-(4-methylpiperazin-1-yl)-[1,2,4]triazolo[1,5-c]quinazoline.
| Compound Name | 7-fluoro-9-isocyano-2-methyl-5-(4-methylpiperazin-1-yl)-[1,2,4]triazolo[1,5-c]quinazoline |
|---|---|
| PubChem CID | 58476020 |
| Molecular Formula | C16H16FN7 |
| Molecular Weight | 325.35 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | 7-fluoro-9-isocyano-2-methyl-5-(4-methylpiperazin-1-yl)-[1,2,4]triazolo[1,5-c]quinazoline |
| SMILES | [C-]#[N+]c1cc(F)c2nc(N3CCN(C)CC3)n3nc(C)nc3c2c1 |
| InChI | InChI=1S/C16H16FN7/c1-10-19-15-12-8-11(18-2)9-13(17)14(12)20-16(24(15)21-10)23-6-4-22(3)5-7-23/h8-9H,4-7H2,1,3H3 |
| InChIKey | HCWRXEJPPXSPMS-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 53.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.35 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|