C27H29ClN4O3 — CID 58476676
4-[[2-[[(7-chloroquinolin-4-yl)amino]methoxymethylamino]ethyl-[(4-hydroxyphenyl)methyl]amino]methyl]phenol (PubChem CID 58476676) has the molecular formula C27H29ClN4O3 and a molecular weight of 493.01 g/mol. Its IUPAC name is 4-[[2-[[(7-chloroquinolin-4-yl)amino]methoxymethylamino]ethyl-[(4-hydroxyphenyl)methyl]amino]methyl]phenol.
| Compound Name | 4-[[2-[[(7-chloroquinolin-4-yl)amino]methoxymethylamino]ethyl-[(4-hydroxyphenyl)methyl]amino]methyl]phenol |
|---|---|
| PubChem CID | 58476676 |
| Molecular Formula | C27H29ClN4O3 |
| Molecular Weight | 493.01 g/mol |
| Exact Mass | 492.19 |
| IUPAC Name | 4-[[2-[[(7-chloroquinolin-4-yl)amino]methoxymethylamino]ethyl-[(4-hydroxyphenyl)methyl]amino]methyl]phenol |
| SMILES | Oc1ccc(CN(CCNCOCNc2ccnc3cc(Cl)ccc23)Cc2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C27H29ClN4O3/c28-22-5-10-25-26(11-12-30-27(25)15-22)31-19-35-18-29-13-14-32(16-20-1-6-23(33)7-2-20)17-21-3-8-24(34)9-4-21/h1-12,15,29,33-34H,13-14,16-19H2,(H,30,31) |
| InChIKey | UUYSOJNPTBDRPO-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 89.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.01 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|