C21H24ClN5O3S — CID 58478090
6-chloro-1-pentyl-3-[4-(5-thiophen-3-yl-1,2,4-oxadiazol-3-yl)butyl]-5H-pyrrolo[2,3-d]pyrimidine-2,4-dione (PubChem CID 58478090) has the molecular formula C21H24ClN5O3S and a molecular weight of 461.98 g/mol. Its IUPAC name is 6-chloro-1-pentyl-3-[4-(5-thiophen-3-yl-1,2,4-oxadiazol-3-yl)butyl]-5H-pyrrolo[2,3-d]pyrimidine-2,4-dione.
| Compound Name | 6-chloro-1-pentyl-3-[4-(5-thiophen-3-yl-1,2,4-oxadiazol-3-yl)butyl]-5H-pyrrolo[2,3-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 58478090 |
| Molecular Formula | C21H24ClN5O3S |
| Molecular Weight | 461.98 g/mol |
| Exact Mass | 461.13 |
| IUPAC Name | 6-chloro-1-pentyl-3-[4-(5-thiophen-3-yl-1,2,4-oxadiazol-3-yl)butyl]-5H-pyrrolo[2,3-d]pyrimidine-2,4-dione |
| SMILES | CCCCCn1c2c(c(=O)n(CCCCc3noc(-c4ccsc4)n3)c1=O)CC(Cl)=N2 |
| InChI | InChI=1S/C21H24ClN5O3S/c1-2-3-5-9-26-18-15(12-16(22)23-18)20(28)27(21(26)29)10-6-4-7-17-24-19(30-25-17)14-8-11-31-13-14/h8,11,13H,2-7,9-10,12H2,1H3 |
| InChIKey | RFZHZBTUOLZVHT-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 95.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.98 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|