C23H26ClN5O3 — CID 58478066
3-[4-(3-benzyl-1,2,4-oxadiazol-5-yl)butyl]-1-butyl-6-chloro-5H-pyrrolo[2,3-d]pyrimidine-2,4-dione (PubChem CID 58478066) has the molecular formula C23H26ClN5O3 and a molecular weight of 455.95 g/mol. Its IUPAC name is 3-[4-(3-benzyl-1,2,4-oxadiazol-5-yl)butyl]-1-butyl-6-chloro-5H-pyrrolo[2,3-d]pyrimidine-2,4-dione.
| Compound Name | 3-[4-(3-benzyl-1,2,4-oxadiazol-5-yl)butyl]-1-butyl-6-chloro-5H-pyrrolo[2,3-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 58478066 |
| Molecular Formula | C23H26ClN5O3 |
| Molecular Weight | 455.95 g/mol |
| Exact Mass | 455.17 |
| IUPAC Name | 3-[4-(3-benzyl-1,2,4-oxadiazol-5-yl)butyl]-1-butyl-6-chloro-5H-pyrrolo[2,3-d]pyrimidine-2,4-dione |
| SMILES | CCCCn1c2c(c(=O)n(CCCCc3nc(Cc4ccccc4)no3)c1=O)CC(Cl)=N2 |
| InChI | InChI=1S/C23H26ClN5O3/c1-2-3-12-28-21-17(15-18(24)25-21)22(30)29(23(28)31)13-8-7-11-20-26-19(27-32-20)14-16-9-5-4-6-10-16/h4-6,9-10H,2-3,7-8,11-15H2,1H3 |
| InChIKey | WCIXUIXIVCKPIV-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 95.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.95 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|