C23H24ClN7O2 — CID 58081717
12-[2-(3-benzyl-1,2,4-oxadiazol-5-yl)ethyl]-5-chloro-8-pentyl-1,6,8,10,11-pentazatricyclo[7.3.0.03,7]dodeca-3(7),5,9,11-tetraen-2-one (PubChem CID 58081717) has the molecular formula C23H24ClN7O2 and a molecular weight of 465.95 g/mol. Its IUPAC name is 12-[2-(3-benzyl-1,2,4-oxadiazol-5-yl)ethyl]-5-chloro-8-pentyl-1,6,8,10,11-pentazatricyclo[7.3.0.03,7]dodeca-3(7),5,9,11-tetraen-2-one.
| Compound Name | 12-[2-(3-benzyl-1,2,4-oxadiazol-5-yl)ethyl]-5-chloro-8-pentyl-1,6,8,10,11-pentazatricyclo[7.3.0.03,7]dodeca-3(7),5,9,11-tetraen-2-one |
|---|---|
| PubChem CID | 58081717 |
| Molecular Formula | C23H24ClN7O2 |
| Molecular Weight | 465.95 g/mol |
| Exact Mass | 465.17 |
| IUPAC Name | 12-[2-(3-benzyl-1,2,4-oxadiazol-5-yl)ethyl]-5-chloro-8-pentyl-1,6,8,10,11-pentazatricyclo[7.3.0.03,7]dodeca-3(7),5,9,11-tetraen-2-one |
| SMILES | CCCCCn1c2c(c(=O)n3c(CCc4nc(Cc5ccccc5)no4)nnc13)CC(Cl)=N2 |
| InChI | InChI=1S/C23H24ClN7O2/c1-2-3-7-12-30-21-16(14-17(24)25-21)22(32)31-19(27-28-23(30)31)10-11-20-26-18(29-33-20)13-15-8-5-4-6-9-15/h4-6,8-9H,2-3,7,10-14H2,1H3 |
| InChIKey | LOPIRHQTOITJPT-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 103.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.95 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|