C24H23BrF3N7O2 — CID 58081665
5-bromo-8-pentyl-12-[2-[3-[[2-(trifluoromethyl)phenyl]methyl]-1,2,4-oxadiazol-5-yl]ethyl]-1,6,8,10,11-pentazatricyclo[7.3.0.03,7]dodeca-3(7),5,9,11-tetraen-2-one (PubChem CID 58081665) has the molecular formula C24H23BrF3N7O2 and a molecular weight of 578.39 g/mol. Its IUPAC name is 5-bromo-8-pentyl-12-[2-[3-[[2-(trifluoromethyl)phenyl]methyl]-1,2,4-oxadiazol-5-yl]ethyl]-1,6,8,10,11-pentazatricyclo[7.3.0.03,7]dodeca-3(7),5,9,11-tetraen-2-one.
| Compound Name | 5-bromo-8-pentyl-12-[2-[3-[[2-(trifluoromethyl)phenyl]methyl]-1,2,4-oxadiazol-5-yl]ethyl]-1,6,8,10,11-pentazatricyclo[7.3.0.03,7]dodeca-3(7),5,9,11-tetraen-2-one |
|---|---|
| PubChem CID | 58081665 |
| Molecular Formula | C24H23BrF3N7O2 |
| Molecular Weight | 578.39 g/mol |
| Exact Mass | 577.10 |
| IUPAC Name | 5-bromo-8-pentyl-12-[2-[3-[[2-(trifluoromethyl)phenyl]methyl]-1,2,4-oxadiazol-5-yl]ethyl]-1,6,8,10,11-pentazatricyclo[7.3.0.03,7]dodeca-3(7),5,9,11-tetraen-2-one |
| SMILES | CCCCCn1c2c(c(=O)n3c(CCc4nc(Cc5ccccc5C(F)(F)F)no4)nnc13)CC(Br)=N2 |
| InChI | InChI=1S/C24H23BrF3N7O2/c1-2-3-6-11-34-21-15(13-17(25)29-21)22(36)35-19(31-32-23(34)35)9-10-20-30-18(33-37-20)12-14-7-4-5-8-16(14)24(26,27)28/h4-5,7-8H,2-3,6,9-13H2,1H3 |
| InChIKey | BAGMCUFTJQAHIF-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 103.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.39 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|