C22H23ClFN5O3 — CID 58478185
1-butyl-6-chloro-3-[4-[5-(4-fluorophenyl)-1,2,4-oxadiazol-3-yl]butyl]-5H-pyrrolo[2,3-d]pyrimidine-2,4-dione (PubChem CID 58478185) has the molecular formula C22H23ClFN5O3 and a molecular weight of 459.91 g/mol. Its IUPAC name is 1-butyl-6-chloro-3-[4-[5-(4-fluorophenyl)-1,2,4-oxadiazol-3-yl]butyl]-5H-pyrrolo[2,3-d]pyrimidine-2,4-dione.
| Compound Name | 1-butyl-6-chloro-3-[4-[5-(4-fluorophenyl)-1,2,4-oxadiazol-3-yl]butyl]-5H-pyrrolo[2,3-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 58478185 |
| Molecular Formula | C22H23ClFN5O3 |
| Molecular Weight | 459.91 g/mol |
| Exact Mass | 459.15 |
| IUPAC Name | 1-butyl-6-chloro-3-[4-[5-(4-fluorophenyl)-1,2,4-oxadiazol-3-yl]butyl]-5H-pyrrolo[2,3-d]pyrimidine-2,4-dione |
| SMILES | CCCCn1c2c(c(=O)n(CCCCc3noc(-c4ccc(F)cc4)n3)c1=O)CC(Cl)=N2 |
| InChI | InChI=1S/C22H23ClFN5O3/c1-2-3-11-28-19-16(13-17(23)25-19)21(30)29(22(28)31)12-5-4-6-18-26-20(32-27-18)14-7-9-15(24)10-8-14/h7-10H,2-6,11-13H2,1H3 |
| InChIKey | WFPFESCQQCVXPL-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 95.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.91 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|