C25H20FNO4S2 — CID 58478480
(2R,3R)-2-[[5-[2-(4-fluorophenyl)ethynyl]thiophen-2-yl]sulfonylmethyl]-3-(1H-indol-3-yl)butanoic acid (PubChem CID 58478480) has the molecular formula C25H20FNO4S2 and a molecular weight of 481.57 g/mol. Its IUPAC name is (2R,3R)-2-[[5-[2-(4-fluorophenyl)ethynyl]thiophen-2-yl]sulfonylmethyl]-3-(1H-indol-3-yl)butanoic acid.
| Compound Name | (2R,3R)-2-[[5-[2-(4-fluorophenyl)ethynyl]thiophen-2-yl]sulfonylmethyl]-3-(1H-indol-3-yl)butanoic acid |
|---|---|
| PubChem CID | 58478480 |
| Molecular Formula | C25H20FNO4S2 |
| Molecular Weight | 481.57 g/mol |
| Exact Mass | 481.08 |
| IUPAC Name | (2R,3R)-2-[[5-[2-(4-fluorophenyl)ethynyl]thiophen-2-yl]sulfonylmethyl]-3-(1H-indol-3-yl)butanoic acid |
| SMILES | C[C@@H](c1c[nH]c2ccccc12)C(CS(=O)(=O)c1ccc(C#Cc2ccc(F)cc2)s1)C(=O)O |
| InChI | InChI=1S/C25H20FNO4S2/c1-16(21-14-27-23-5-3-2-4-20(21)23)22(25(28)29)15-33(30,31)24-13-12-19(32-24)11-8-17-6-9-18(26)10-7-17/h2-7,9-10,12-14,16,22,27H,15H2,1H3,(H,28,29)/t16-,22?/m0/s1 |
| InChIKey | VEULSGZJOLMCNE-CISYCMJJSA-N |
| XLogP | 5.05 |
| TPSA | 87.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.57 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|